Issued Patents All Time
Showing 1–3 of 3 patents
| Patent # | Title | Co-Inventors | Date |
|---|---|---|---|
| 5204456 | Derivatives of nucleosides and their use for the synthesis of oligonucleotides | Didier Molko, Robert Teoule | 1993-04-20 |
| 5179200 | N4-(3-phenylproprionyl)-2'-deoxycytidine | Didier Molko, Andre Roget, Robert Teoule | 1993-01-12 |
| 4980460 | Protected nucleosides which permit more efficient oligonucleotide syntheses | Didier Molko, Robert Teoule | 1990-12-25 |