Issued Patents All Time
Showing 1–12 of 12 patents
| Patent # | Title | Co-Inventors | Date |
|---|---|---|---|
| 6210932 | System for detecting nucleic acid hybridization, preparation method and application thereof | Sylvie Sauvaigo, Herve Bazin | 2001-04-03 |
| 6207797 | Method for reducing the surface reactivity of copolymers produced by electrochemical polymerization | Thierry Livache, Andre Roget | 2001-03-27 |
| 6197949 | Electronically conductive polymer/nucleotide copolymer. preparation method therefor and use thereof | Andre Roget, Thierry Livache, Christelle Barthet, Gerard Bidan | 2001-03-06 |
| 6187914 | Nucleoside derivatives, and their use in oligonucleotide synthesis | Andre Roget, Thierry Livache | 2001-02-13 |
| 5837859 | Preparation of a electronically conductive polymer/nucleotide copolymer | Andre Roget, Thierry Livache, Christelle Barthet, Gerard Bidan | 1998-11-17 |
| 5795715 | Process for preparing double-stranded RNA, and its applications | Thierry Livache, Brigitte Fouque | 1998-08-18 |
| 5776791 | Process for collective manufacture of chips with electrodes selectively covered by a deposit | Patrice Caillat, Gerard Nicolas | 1998-07-07 |
| 5552539 | Process for the synthesis of ribonucleic acid (RNA) using a novel deprotection reagent | Anne-Marie Duplaa, Didier Gasparutto, Thierry Livache, Didier Molko | 1996-09-03 |
| 5514540 | Method for detecting specific nucleic acid sequences by amplification in highly dilute solution | Thierry Livache, Brigitte Fouque, Sylvie Sauvaigo | 1996-05-07 |
| 5204456 | Derivatives of nucleosides and their use for the synthesis of oligonucleotides | Didier Molko, Jean-Claude Schulhof | 1993-04-20 |
| 5179200 | N4-(3-phenylproprionyl)-2'-deoxycytidine | Didier Molko, Andre Roget, Jean-Claude Schulhof | 1993-01-12 |
| 4980460 | Protected nucleosides which permit more efficient oligonucleotide syntheses | Didier Molko, Jean-Claude Schulhof | 1990-12-25 |